C12H16N2O3S — CID 166604192
1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]propan-1-one (PubChem CID 166604192) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]propan-1-one.
| Compound Name | 1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 166604192 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(N2CCS(=O)(=O)CC2)nc1 |
| InChI | InChI=1S/C12H16N2O3S/c1-2-11(15)10-3-4-12(13-9-10)14-5-7-18(16,17)8-6-14/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | OQKSIHOAPUVEAX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |