C18H17N7 — CID 166605534
4-(4-imidazo[1,2-a]pyrazin-8-ylpiperazin-1-yl)quinazoline (PubChem CID 166605534) has the molecular formula C18H17N7 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-(4-imidazo[1,2-a]pyrazin-8-ylpiperazin-1-yl)quinazoline.
| Compound Name | 4-(4-imidazo[1,2-a]pyrazin-8-ylpiperazin-1-yl)quinazoline |
|---|---|
| PubChem CID | 166605534 |
| Molecular Formula | C18H17N7 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-(4-imidazo[1,2-a]pyrazin-8-ylpiperazin-1-yl)quinazoline |
| SMILES | c1ccc2c(N3CCN(c4nccn5ccnc45)CC3)ncnc2c1 |
| InChI | InChI=1S/C18H17N7/c1-2-4-15-14(3-1)16(22-13-21-15)24-9-11-25(12-10-24)18-17-19-5-7-23(17)8-6-20-18/h1-8,13H,9-12H2 |
| InChIKey | JZCSKVQXGRYASO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |