C19H20BrN5O — CID 166605676
6-bromo-2-[4-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]quinazoline (PubChem CID 166605676) has the molecular formula C19H20BrN5O and a molecular weight of 414.31 g/mol. Its IUPAC name is 6-bromo-2-[4-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]quinazoline.
| Compound Name | 6-bromo-2-[4-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 166605676 |
| Molecular Formula | C19H20BrN5O |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 6-bromo-2-[4-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]quinazoline |
| SMILES | COc1cc(CN2CCN(c3ncc4cc(Br)ccc4n3)CC2)ccn1 |
| InChI | InChI=1S/C19H20BrN5O/c1-26-18-10-14(4-5-21-18)13-24-6-8-25(9-7-24)19-22-12-15-11-16(20)2-3-17(15)23-19/h2-5,10-12H,6-9,13H2,1H3 |
| InChIKey | DAFBAMDSUYONBO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |