C18H21BrFN3O — CID 171701507
1-[(3-bromo-2-fluorophenyl)methyl]-4-[(2-methoxy-4-pyridinyl)methyl]piperazine (PubChem CID 171701507) has the molecular formula C18H21BrFN3O and a molecular weight of 394.29 g/mol. Its IUPAC name is 1-[(3-bromo-2-fluorophenyl)methyl]-4-[(2-methoxy-4-pyridinyl)methyl]piperazine.
| Compound Name | 1-[(3-bromo-2-fluorophenyl)methyl]-4-[(2-methoxy-4-pyridinyl)methyl]piperazine |
|---|---|
| PubChem CID | 171701507 |
| Molecular Formula | C18H21BrFN3O |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-[(3-bromo-2-fluorophenyl)methyl]-4-[(2-methoxy-4-pyridinyl)methyl]piperazine |
| SMILES | COc1cc(CN2CCN(Cc3cccc(Br)c3F)CC2)ccn1 |
| InChI | InChI=1S/C18H21BrFN3O/c1-24-17-11-14(5-6-21-17)12-22-7-9-23(10-8-22)13-15-3-2-4-16(19)18(15)20/h2-6,11H,7-10,12-13H2,1H3 |
| InChIKey | PSGZRLDBADIPJX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |