C9H3Cl2F3O — CID 166609364
5,6-dichloro-3-(trifluoromethyl)-1-benzofuran (PubChem CID 166609364) has the molecular formula C9H3Cl2F3O and a molecular weight of 255.02 g/mol. Its IUPAC name is 5,6-dichloro-3-(trifluoromethyl)-1-benzofuran.
| Compound Name | 5,6-dichloro-3-(trifluoromethyl)-1-benzofuran |
|---|---|
| PubChem CID | 166609364 |
| Molecular Formula | C9H3Cl2F3O |
| Molecular Weight | 255.02 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | 5,6-dichloro-3-(trifluoromethyl)-1-benzofuran |
| SMILES | FC(F)(F)c1coc2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C9H3Cl2F3O/c10-6-1-4-5(9(12,13)14)3-15-8(4)2-7(6)11/h1-3H |
| InChIKey | ANQGXFIXJIYVLK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.02 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |