C10H5F3O3 — CID 166609361
7-(trifluoromethyl)furo[2,3-f][1,3]benzodioxole (PubChem CID 166609361) has the molecular formula C10H5F3O3 and a molecular weight of 230.14 g/mol. Its IUPAC name is 7-(trifluoromethyl)furo[2,3-f][1,3]benzodioxole.
| Compound Name | 7-(trifluoromethyl)furo[2,3-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 166609361 |
| Molecular Formula | C10H5F3O3 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 7-(trifluoromethyl)furo[2,3-f][1,3]benzodioxole |
| SMILES | FC(F)(F)c1coc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C10H5F3O3/c11-10(12,13)6-3-14-7-2-9-8(1-5(6)7)15-4-16-9/h1-3H,4H2 |
| InChIKey | UOVCUHSVJVLLBJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |