C12H12F3NO2 — CID 84709827
3-[6-(trifluoromethyl)-1,3-benzodioxol-5-yl]pyrrolidine (PubChem CID 84709827) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 3-[6-(trifluoromethyl)-1,3-benzodioxol-5-yl]pyrrolidine.
| Compound Name | 3-[6-(trifluoromethyl)-1,3-benzodioxol-5-yl]pyrrolidine |
|---|---|
| PubChem CID | 84709827 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-[6-(trifluoromethyl)-1,3-benzodioxol-5-yl]pyrrolidine |
| SMILES | FC(F)(F)c1cc2c(cc1C1CCNC1)OCO2 |
| InChI | InChI=1S/C12H12F3NO2/c13-12(14,15)9-4-11-10(17-6-18-11)3-8(9)7-1-2-16-5-7/h3-4,7,16H,1-2,5-6H2 |
| InChIKey | LAACOAAKFKJBCM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |