C14H13F3O2 — CID 164669327
5-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)-1,3-benzodioxole (PubChem CID 164669327) has the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 5-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)-1,3-benzodioxole.
| Compound Name | 5-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 164669327 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)-1,3-benzodioxole |
| SMILES | FC(F)(F)c1cc2c(cc1[C@@H]1C=CCCC1)OCO2 |
| InChI | InChI=1S/C14H13F3O2/c15-14(16,17)11-7-13-12(18-8-19-13)6-10(11)9-4-2-1-3-5-9/h2,4,6-7,9H,1,3,5,8H2/t9-/m1/s1 |
| InChIKey | ADYMYKHCSFWYGC-SECBINFHSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|