C15H12ClF6NO — CID 162537558
N-[6-chloro-2-cyclohex-2-en-1-yl-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 162537558) has the molecular formula C15H12ClF6NO and a molecular weight of 371.71 g/mol. Its IUPAC name is N-[6-chloro-2-cyclohex-2-en-1-yl-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-chloro-2-cyclohex-2-en-1-yl-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162537558 |
| Molecular Formula | C15H12ClF6NO |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-[6-chloro-2-cyclohex-2-en-1-yl-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1c(Cl)ccc(C(F)(F)F)c1C1C=CCCC1)C(F)(F)F |
| InChI | InChI=1S/C15H12ClF6NO/c16-10-7-6-9(14(17,18)19)11(8-4-2-1-3-5-8)12(10)23-13(24)15(20,21)22/h2,4,6-8H,1,3,5H2,(H,23,24) |
| InChIKey | MZKHUOHWYPXFKK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|