About trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol
trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol (PubChem CID 102733047) has the molecular formula C12H13ClF3NO
and a molecular weight of 279.69 g/mol. Its IUPAC name is trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol |
| PubChem CID | 102733047 |
| Molecular Formula | C12H13ClF3NO |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H13ClF3NO/c13-8-4-1-3-7(12(14,15)16)11(8)17-9-5-2-6-10(9)18/h1,3-4,9-10,17-18H,2,5-6H2/t9-,10-/m0/s1 |
| InChIKey | FRSIHQNKESDGLU-UWVGGRQHSA-N |
| XLogP | 3.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol?
The IUPAC name of trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol (CID 102733047) is trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol.
What is the SMILES notation for trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol?
The canonical SMILES for trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol is O[C@H]1CCC[C@@H]1Nc1c(Cl)cccc1C(F)(F)F.
What is the InChIKey of trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol?
The InChIKey is FRSIHQNKESDGLU-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H13ClF3NO/c13-8-4-1-3-7(12(14,15)16)11(8)17-9-5-2-6-10(9)18/h1,3-4,9-10,17-18H,2,5-6H2/t9-,10-/m0/s1.
What are the key properties of trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol?
trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol has a molecular weight of 279.69 g/mol, XLogP of 3.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-[2-chloro-6-(trifluoromethyl)anilino]cyclopentan-1-ol is sourced from PubChem (CID 102733047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).