C10H10Cl2N2 — CID 129110748
3,6-dichloro-4-cyclohex-2-en-1-ylpyridazine (PubChem CID 129110748) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 3,6-dichloro-4-cyclohex-2-en-1-ylpyridazine.
| Compound Name | 3,6-dichloro-4-cyclohex-2-en-1-ylpyridazine |
|---|---|
| PubChem CID | 129110748 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 3,6-dichloro-4-cyclohex-2-en-1-ylpyridazine |
| SMILES | Clc1cc(C2C=CCCC2)c(Cl)nn1 |
| InChI | InChI=1S/C10H10Cl2N2/c11-9-6-8(10(12)14-13-9)7-4-2-1-3-5-7/h2,4,6-7H,1,3,5H2 |
| InChIKey | MOVACWKGFBOKKZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|