C11H12Cl2N2S — CID 46868231
4,6-dichloro-5-cyclohex-2-en-1-yl-2-methylsulfanylpyrimidine (PubChem CID 46868231) has the molecular formula C11H12Cl2N2S and a molecular weight of 275.20 g/mol. Its IUPAC name is 4,6-dichloro-5-cyclohex-2-en-1-yl-2-methylsulfanylpyrimidine.
| Compound Name | 4,6-dichloro-5-cyclohex-2-en-1-yl-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 46868231 |
| Molecular Formula | C11H12Cl2N2S |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 4,6-dichloro-5-cyclohex-2-en-1-yl-2-methylsulfanylpyrimidine |
| SMILES | CSc1nc(Cl)c(C2C=CCCC2)c(Cl)n1 |
| InChI | InChI=1S/C11H12Cl2N2S/c1-16-11-14-9(12)8(10(13)15-11)7-5-3-2-4-6-7/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | SBTZBSGZRKOCPH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|