C12H16N2 — CID 156842568
4-cyclohex-2-en-1-yl-2,5-dimethylpyrimidine (PubChem CID 156842568) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-cyclohex-2-en-1-yl-2,5-dimethylpyrimidine.
| Compound Name | 4-cyclohex-2-en-1-yl-2,5-dimethylpyrimidine |
|---|---|
| PubChem CID | 156842568 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4-cyclohex-2-en-1-yl-2,5-dimethylpyrimidine |
| SMILES | Cc1ncc(C)c(C2C=CCCC2)n1 |
| InChI | InChI=1S/C12H16N2/c1-9-8-13-10(2)14-12(9)11-6-4-3-5-7-11/h4,6,8,11H,3,5,7H2,1-2H3 |
| InChIKey | KKFTZOPUFRXVBZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|