C13H10Cl2N2 — CID 169288678
3,6-dichloro-4-[(1S,2S)-2-phenylcyclopropyl]pyridazine (PubChem CID 169288678) has the molecular formula C13H10Cl2N2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 3,6-dichloro-4-[(1S,2S)-2-phenylcyclopropyl]pyridazine.
| Compound Name | 3,6-dichloro-4-[(1S,2S)-2-phenylcyclopropyl]pyridazine |
|---|---|
| PubChem CID | 169288678 |
| Molecular Formula | C13H10Cl2N2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 3,6-dichloro-4-[(1S,2S)-2-phenylcyclopropyl]pyridazine |
| SMILES | Clc1cc([C@H]2C[C@@H]2c2ccccc2)c(Cl)nn1 |
| InChI | InChI=1S/C13H10Cl2N2/c14-12-7-11(13(15)17-16-12)10-6-9(10)8-4-2-1-3-5-8/h1-5,7,9-10H,6H2/t9-,10+/m1/s1 |
| InChIKey | DJMRHLQSIQWHAZ-ZJUUUORDSA-N |
| XLogP | 4.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |