C17H15ClN2 — CID 20604133
4-chloro-2-(2-phenylcyclopropyl)-1,4-dihydroquinazoline (PubChem CID 20604133) has the molecular formula C17H15ClN2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-chloro-2-(2-phenylcyclopropyl)-1,4-dihydroquinazoline.
| Compound Name | 4-chloro-2-(2-phenylcyclopropyl)-1,4-dihydroquinazoline |
|---|---|
| PubChem CID | 20604133 |
| Molecular Formula | C17H15ClN2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-chloro-2-(2-phenylcyclopropyl)-1,4-dihydroquinazoline |
| SMILES | ClC1N=C(C2CC2c2ccccc2)Nc2ccccc21 |
| InChI | InChI=1S/C17H15ClN2/c18-16-12-8-4-5-9-15(12)19-17(20-16)14-10-13(14)11-6-2-1-3-7-11/h1-9,13-14,16H,10H2,(H,19,20) |
| InChIKey | FHAVAPCQFDTYEU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|