C17H19N3O3S — CID 16661012
(2S)-N-hydroxy-3-oxo-2-propan-2-yl-1-(thiophen-2-ylmethyl)-2,4-dihydroquinoxaline-6-carboxamide (PubChem CID 16661012) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2S)-N-hydroxy-3-oxo-2-propan-2-yl-1-(thiophen-2-ylmethyl)-2,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | (2S)-N-hydroxy-3-oxo-2-propan-2-yl-1-(thiophen-2-ylmethyl)-2,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 16661012 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2S)-N-hydroxy-3-oxo-2-propan-2-yl-1-(thiophen-2-ylmethyl)-2,4-dihydroquinoxaline-6-carboxamide |
| SMILES | CC(C)[C@H]1C(=O)Nc2cc(C(=O)NO)ccc2N1Cc1cccs1 |
| InChI | InChI=1S/C17H19N3O3S/c1-10(2)15-17(22)18-13-8-11(16(21)19-23)5-6-14(13)20(15)9-12-4-3-7-24-12/h3-8,10,15,23H,9H2,1-2H3,(H,18,22)(H,19,21)/t15-/m0/s1 |
| InChIKey | WAABEKBNHNJIMT-HNNXBMFYSA-N |
| XLogP | 2.85 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|