C12H14BN3O3 — CID 58916434
CID 58916434 (PubChem CID 58916434) has the molecular formula C12H14BN3O3 and a molecular weight of 259.07 g/mol.
| Compound Name | CID 58916434 |
|---|---|
| PubChem CID | 58916434 |
| Molecular Formula | C12H14BN3O3 |
| Molecular Weight | 259.07 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | — |
| SMILES | [B]N1c2ccc(C(=O)NO)cc2NC(=O)[C@@H]1C(C)C |
| InChI | InChI=1S/C12H14BN3O3/c1-6(2)10-12(18)14-8-5-7(11(17)15-19)3-4-9(8)16(10)13/h3-6,10,19H,1-2H3,(H,14,18)(H,15,17)/t10-/m0/s1 |
| InChIKey | VVGKBMXOTBWIHC-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.07 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|