C13H15N3O4 — CID 16660183
(3R)-N-hydroxy-2,5-dioxo-3-propan-2-yl-3,4-dihydro-1H-1,4-benzodiazepine-8-carboxamide (PubChem CID 16660183) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is (3R)-N-hydroxy-2,5-dioxo-3-propan-2-yl-3,4-dihydro-1H-1,4-benzodiazepine-8-carboxamide.
| Compound Name | (3R)-N-hydroxy-2,5-dioxo-3-propan-2-yl-3,4-dihydro-1H-1,4-benzodiazepine-8-carboxamide |
|---|---|
| PubChem CID | 16660183 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (3R)-N-hydroxy-2,5-dioxo-3-propan-2-yl-3,4-dihydro-1H-1,4-benzodiazepine-8-carboxamide |
| SMILES | CC(C)[C@H]1NC(=O)c2ccc(C(=O)NO)cc2NC1=O |
| InChI | InChI=1S/C13H15N3O4/c1-6(2)10-13(19)14-9-5-7(11(17)16-20)3-4-8(9)12(18)15-10/h3-6,10,20H,1-2H3,(H,14,19)(H,15,18)(H,16,17)/t10-/m1/s1 |
| InChIKey | LCXGLBPKSGMDDK-SNVBAGLBSA-N |
| XLogP | 0.51 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|