C6H3F6NOS — CID 166610479
1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-4-yl)propan-2-ol (PubChem CID 166610479) has the molecular formula C6H3F6NOS and a molecular weight of 251.15 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-4-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 166610479 |
| Molecular Formula | C6H3F6NOS |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-4-yl)propan-2-ol |
| SMILES | OC(c1cscn1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F6NOS/c7-5(8,9)4(14,6(10,11)12)3-1-15-2-13-3/h1-2,14H |
| InChIKey | JDDAJCQUXBWEHZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |