C6H2F5NOS — CID 130688334
2,2,3,3,3-pentafluoro-1-(1,3-thiazol-4-yl)propan-1-one (PubChem CID 130688334) has the molecular formula C6H2F5NOS and a molecular weight of 231.15 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(1,3-thiazol-4-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(1,3-thiazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 130688334 |
| Molecular Formula | C6H2F5NOS |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(1,3-thiazol-4-yl)propan-1-one |
| SMILES | O=C(c1cscn1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F5NOS/c7-5(8,6(9,10)11)4(13)3-1-14-2-12-3/h1-2H |
| InChIKey | JYYPNGAGPUAPQT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|