C5H3NO3S — CID 13187915
2-oxo-2-(1,3-thiazol-4-yl)acetic acid (PubChem CID 13187915) has the molecular formula C5H3NO3S and a molecular weight of 157.15 g/mol. Its IUPAC name is 2-oxo-2-(1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-oxo-2-(1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 13187915 |
| Molecular Formula | C5H3NO3S |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | 2-oxo-2-(1,3-thiazol-4-yl)acetic acid |
| SMILES | O=C(O)C(=O)c1cscn1 |
| InChI | InChI=1S/C5H3NO3S/c7-4(5(8)9)3-1-10-2-6-3/h1-2H,(H,8,9) |
| InChIKey | ACMQDYGRLRKUPD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|