C6H7NOS2 — CID 126971676
2-methylsulfanyl-1-(1,3-thiazol-4-yl)ethanone (PubChem CID 126971676) has the molecular formula C6H7NOS2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methylsulfanyl-1-(1,3-thiazol-4-yl)ethanone.
| Compound Name | 2-methylsulfanyl-1-(1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 126971676 |
| Molecular Formula | C6H7NOS2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.00 |
| IUPAC Name | 2-methylsulfanyl-1-(1,3-thiazol-4-yl)ethanone |
| SMILES | CSCC(=O)c1cscn1 |
| InChI | InChI=1S/C6H7NOS2/c1-9-3-6(8)5-2-10-4-7-5/h2,4H,3H2,1H3 |
| InChIKey | TXTWTHVNBKRPIO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |