C8H8N2O3S2 — CID 23347854
S-(2-acetamido-2-oxoethyl) 1,3-thiazole-4-carbothioate (PubChem CID 23347854) has the molecular formula C8H8N2O3S2 and a molecular weight of 244.30 g/mol. Its IUPAC name is S-(2-acetamido-2-oxoethyl) 1,3-thiazole-4-carbothioate.
| Compound Name | S-(2-acetamido-2-oxoethyl) 1,3-thiazole-4-carbothioate |
|---|---|
| PubChem CID | 23347854 |
| Molecular Formula | C8H8N2O3S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | S-(2-acetamido-2-oxoethyl) 1,3-thiazole-4-carbothioate |
| SMILES | CC(=O)NC(=O)CSC(=O)c1cscn1 |
| InChI | InChI=1S/C8H8N2O3S2/c1-5(11)10-7(12)3-15-8(13)6-2-14-4-9-6/h2,4H,3H2,1H3,(H,10,11,12) |
| InChIKey | CROYOTVDNVOBAF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|