C6H7NO2S — CID 130672271
2-hydroxy-1-(1,3-thiazol-4-yl)propan-1-one (PubChem CID 130672271) has the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. Its IUPAC name is 2-hydroxy-1-(1,3-thiazol-4-yl)propan-1-one.
| Compound Name | 2-hydroxy-1-(1,3-thiazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 130672271 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 2-hydroxy-1-(1,3-thiazol-4-yl)propan-1-one |
| SMILES | CC(O)C(=O)c1cscn1 |
| InChI | InChI=1S/C6H7NO2S/c1-4(8)6(9)5-2-10-3-7-5/h2-4,8H,1H3 |
| InChIKey | ONSKGCNWYADZLE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |