About 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one
2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one (PubChem CID 130610113) has the molecular formula C12H11NOS
and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one |
| PubChem CID | 130610113 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one |
| SMILES | CC(C(=O)c1cscn1)c1ccccc1 |
| InChI | InChI=1S/C12H11NOS/c1-9(10-5-3-2-4-6-10)12(14)11-7-15-8-13-11/h2-9H,1H3 |
| InChIKey | KPEDWEVOOFKYDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one?
The IUPAC name of 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one (CID 130610113) is 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one.
What is the SMILES notation for 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one?
The canonical SMILES for 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one is CC(C(=O)c1cscn1)c1ccccc1.
What is the InChIKey of 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one?
The InChIKey is KPEDWEVOOFKYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NOS/c1-9(10-5-3-2-4-6-10)12(14)11-7-15-8-13-11/h2-9H,1H3.
What are the key properties of 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one?
2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one has a molecular weight of 217.29 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one is sourced from PubChem (CID 130610113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).