C12H11NOS — CID 130610113
2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one (PubChem CID 130610113) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one.
| Compound Name | 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 130610113 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-phenyl-1-(1,3-thiazol-4-yl)propan-1-one |
| SMILES | CC(C(=O)c1cscn1)c1ccccc1 |
| InChI | InChI=1S/C12H11NOS/c1-9(10-5-3-2-4-6-10)12(14)11-7-15-8-13-11/h2-9H,1H3 |
| InChIKey | KPEDWEVOOFKYDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |