C21H28FN3O3 — CID 166615143
3-ethyl-8-[2-(3-fluorophenyl)acetyl]-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 166615143) has the molecular formula C21H28FN3O3 and a molecular weight of 389.47 g/mol. Its IUPAC name is 3-ethyl-8-[2-(3-fluorophenyl)acetyl]-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-ethyl-8-[2-(3-fluorophenyl)acetyl]-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 166615143 |
| Molecular Formula | C21H28FN3O3 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 3-ethyl-8-[2-(3-fluorophenyl)acetyl]-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(CC(C)C)C2(CCN(C(=O)Cc3cccc(F)c3)CC2)C1=O |
| InChI | InChI=1S/C21H28FN3O3/c1-4-24-19(27)21(25(20(24)28)14-15(2)3)8-10-23(11-9-21)18(26)13-16-6-5-7-17(22)12-16/h5-7,12,15H,4,8-11,13-14H2,1-3H3 |
| InChIKey | NURLRKHAADSHBR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|