C20H25F2N3O3 — CID 165428635
8-[2-(2,4-difluorophenyl)acetyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165428635) has the molecular formula C20H25F2N3O3 and a molecular weight of 393.43 g/mol. Its IUPAC name is 8-[2-(2,4-difluorophenyl)acetyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[2-(2,4-difluorophenyl)acetyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165428635 |
| Molecular Formula | C20H25F2N3O3 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 8-[2-(2,4-difluorophenyl)acetyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)CN1C(=O)N(C)C(=O)C12CCN(C(=O)Cc1ccc(F)cc1F)CC2 |
| InChI | InChI=1S/C20H25F2N3O3/c1-13(2)12-25-19(28)23(3)18(27)20(25)6-8-24(9-7-20)17(26)10-14-4-5-15(21)11-16(14)22/h4-5,11,13H,6-10,12H2,1-3H3 |
| InChIKey | ORFRNQFDNWJYMG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|