C21H28FN3O6 — CID 166600307
acetic acid;8-(2-fluoro-4-hydroxybenzoyl)-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 166600307) has the molecular formula C21H28FN3O6 and a molecular weight of 437.47 g/mol. Its IUPAC name is acetic acid;8-(2-fluoro-4-hydroxybenzoyl)-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | acetic acid;8-(2-fluoro-4-hydroxybenzoyl)-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 166600307 |
| Molecular Formula | C21H28FN3O6 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | acetic acid;8-(2-fluoro-4-hydroxybenzoyl)-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(=O)O.CC(C)CN1C(=O)N(C)C(=O)C12CCN(C(=O)c1ccc(O)cc1F)CC2 |
| InChI | InChI=1S/C19H24FN3O4.C2H4O2/c1-12(2)11-23-18(27)21(3)17(26)19(23)6-8-22(9-7-19)16(25)14-5-4-13(24)10-15(14)20;1-2(3)4/h4-5,10,12,24H,6-9,11H2,1-3H3;1H3,(H,3,4) |
| InChIKey | SQYGSXQTEJWRLW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|