C19H26FN3O4S — CID 165426746
8-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165426746) has the molecular formula C19H26FN3O4S and a molecular weight of 411.50 g/mol. Its IUPAC name is 8-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165426746 |
| Molecular Formula | C19H26FN3O4S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 8-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N2CCC3(CC2)C(=O)N(C)C(=O)N3CC(C)C)c1 |
| InChI | InChI=1S/C19H26FN3O4S/c1-13(2)12-23-18(25)21(4)17(24)19(23)7-9-22(10-8-19)28(26,27)16-11-14(3)5-6-15(16)20/h5-6,11,13H,7-10,12H2,1-4H3 |
| InChIKey | ZZLMSPTWDITVAK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|