C20H24N4O3 — CID 165417513
4-[3-methyl-1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl]benzonitrile (PubChem CID 165417513) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-[3-methyl-1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl]benzonitrile.
| Compound Name | 4-[3-methyl-1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 165417513 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-[3-methyl-1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl]benzonitrile |
| SMILES | CC(C)CN1C(=O)N(C)C(=O)C12CCN(C(=O)c1ccc(C#N)cc1)CC2 |
| InChI | InChI=1S/C20H24N4O3/c1-14(2)13-24-19(27)22(3)18(26)20(24)8-10-23(11-9-20)17(25)16-6-4-15(12-21)5-7-16/h4-7,14H,8-11,13H2,1-3H3 |
| InChIKey | LRQLTYLCNMTIHP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|