C19H23N3O3S — CID 166615796
1-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]methyl]thiophen-2-yl]ethanone (PubChem CID 166615796) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]methyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]methyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 166615796 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]methyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2C[C@H]3CN(C(=O)c4ccc[nH]4)C[C@@]3(CO)C2)cs1 |
| InChI | InChI=1S/C19H23N3O3S/c1-13(24)17-5-14(9-26-17)6-21-7-15-8-22(11-19(15,10-21)12-23)18(25)16-3-2-4-20-16/h2-5,9,15,20,23H,6-8,10-12H2,1H3/t15-,19+/m0/s1 |
| InChIKey | AQMYFGQBDQSJIT-HNAYVOBHSA-N |
| XLogP | 1.85 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |