C22H29NO2S — CID 26319393
1-[4-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone (PubChem CID 26319393) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-[4-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 26319393 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 1-[4-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2CCC(CO)(CCCc3ccccc3)CC2)cs1 |
| InChI | InChI=1S/C22H29NO2S/c1-18(25)21-14-20(16-26-21)15-23-12-10-22(17-24,11-13-23)9-5-8-19-6-3-2-4-7-19/h2-4,6-7,14,16,24H,5,8-13,15,17H2,1H3 |
| InChIKey | USIIDLYUPMDITC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |