C23H31NO3 — CID 42288726
2-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]-5-methoxyphenol (PubChem CID 42288726) has the molecular formula C23H31NO3 and a molecular weight of 369.50 g/mol. Its IUPAC name is 2-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]-5-methoxyphenol.
| Compound Name | 2-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 42288726 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-[[4-(hydroxymethyl)-4-(3-phenylpropyl)piperidin-1-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2CCC(CO)(CCCc3ccccc3)CC2)c(O)c1 |
| InChI | InChI=1S/C23H31NO3/c1-27-21-10-9-20(22(26)16-21)17-24-14-12-23(18-25,13-15-24)11-5-8-19-6-3-2-4-7-19/h2-4,6-7,9-10,16,25-26H,5,8,11-15,17-18H2,1H3 |
| InChIKey | KORYKXOEDOMMJP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|