C21H31N3O3 — CID 166618468
2-[(2S,5R)-5-(acetamidomethyl)-1-(cyclopropylmethyl)pyrrolidin-2-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 166618468) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[(2S,5R)-5-(acetamidomethyl)-1-(cyclopropylmethyl)pyrrolidin-2-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[(2S,5R)-5-(acetamidomethyl)-1-(cyclopropylmethyl)pyrrolidin-2-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 166618468 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-[(2S,5R)-5-(acetamidomethyl)-1-(cyclopropylmethyl)pyrrolidin-2-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | CC(=O)NC[C@H]1CC[C@@H](CC(=O)NCCOc2ccccc2)N1CC1CC1 |
| InChI | InChI=1S/C21H31N3O3/c1-16(25)23-14-19-10-9-18(24(19)15-17-7-8-17)13-21(26)22-11-12-27-20-5-3-2-4-6-20/h2-6,17-19H,7-15H2,1H3,(H,22,26)(H,23,25)/t18-,19+/m0/s1 |
| InChIKey | PZCWPCUOEDWXDB-RBUKOAKNSA-N |
| XLogP | 1.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|