C28H31N5O6S — CID 166618614
(10S,13S,16S)-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-N-(1,3-thiazol-4-ylmethyl)-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide (PubChem CID 166618614) has the molecular formula C28H31N5O6S and a molecular weight of 565.65 g/mol. Its IUPAC name is (10S,13S,16S)-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-N-(1,3-thiazol-4-ylmethyl)-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide.
| Compound Name | (10S,13S,16S)-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-N-(1,3-thiazol-4-ylmethyl)-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide |
|---|---|
| PubChem CID | 166618614 |
| Molecular Formula | C28H31N5O6S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (10S,13S,16S)-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-N-(1,3-thiazol-4-ylmethyl)-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide |
| SMILES | CC(C)[C@@H]1NC(=O)c2cc(ccc2O)Oc2ccc(cc2)C[C@@H](C(=O)NCc2cscn2)NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C28H31N5O6S/c1-15(2)24-28(38)31-16(3)25(35)32-22(27(37)29-12-18-13-40-14-30-18)10-17-4-6-19(7-5-17)39-20-8-9-23(34)21(11-20)26(36)33-24/h4-9,11,13-16,22,24,34H,10,12H2,1-3H3,(H,29,37)(H,31,38)(H,32,35)(H,33,36)/t16-,22-,24-/m0/s1 |
| InChIKey | NFISNSLBYXUQNV-DQLWACAZSA-N |
| XLogP | 2.26 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|