C32H33N5O6 — CID 166621923
(10S,13S,16S)-N-[(3-cyanophenyl)methyl]-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide (PubChem CID 166621923) has the molecular formula C32H33N5O6 and a molecular weight of 583.65 g/mol. Its IUPAC name is (10S,13S,16S)-N-[(3-cyanophenyl)methyl]-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide.
| Compound Name | (10S,13S,16S)-N-[(3-cyanophenyl)methyl]-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide |
|---|---|
| PubChem CID | 166621923 |
| Molecular Formula | C32H33N5O6 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | (10S,13S,16S)-N-[(3-cyanophenyl)methyl]-6-hydroxy-13-methyl-8,11,14-trioxo-10-propan-2-yl-2-oxa-9,12,15-triazatricyclo[16.2.2.13,7]tricosa-1(20),3(23),4,6,18,21-hexaene-16-carboxamide |
| SMILES | CC(C)[C@@H]1NC(=O)c2cc(ccc2O)Oc2ccc(cc2)C[C@@H](C(=O)NCc2cccc(C#N)c2)NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C32H33N5O6/c1-18(2)28-32(42)35-19(3)29(39)36-26(31(41)34-17-22-6-4-5-21(13-22)16-33)14-20-7-9-23(10-8-20)43-24-11-12-27(38)25(15-24)30(40)37-28/h4-13,15,18-19,26,28,38H,14,17H2,1-3H3,(H,34,41)(H,35,42)(H,36,39)(H,37,40)/t19-,26-,28-/m0/s1 |
| InChIKey | VBTJBBGJILOQIR-OOXLZHEQSA-N |
| XLogP | 2.67 |
| TPSA | 169.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|