C22H25N5O3 — CID 166623594
4-[[3-[4-(2-hydroxyethylamino)quinazolin-6-yl]-4-methoxyphenyl]methyl]piperazin-2-one (PubChem CID 166623594) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[[3-[4-(2-hydroxyethylamino)quinazolin-6-yl]-4-methoxyphenyl]methyl]piperazin-2-one.
| Compound Name | 4-[[3-[4-(2-hydroxyethylamino)quinazolin-6-yl]-4-methoxyphenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 166623594 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-[[3-[4-(2-hydroxyethylamino)quinazolin-6-yl]-4-methoxyphenyl]methyl]piperazin-2-one |
| SMILES | COc1ccc(CN2CCNC(=O)C2)cc1-c1ccc2ncnc(NCCO)c2c1 |
| InChI | InChI=1S/C22H25N5O3/c1-30-20-5-2-15(12-27-8-6-23-21(29)13-27)10-17(20)16-3-4-19-18(11-16)22(24-7-9-28)26-14-25-19/h2-5,10-11,14,28H,6-9,12-13H2,1H3,(H,23,29)(H,24,25,26) |
| InChIKey | ZWOKHQUHCFOCLT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |