C19H28N2O4S — CID 166623832
[3-benzyl-1-(1-methylsulfonylpropan-2-yl)azetidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 166623832) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is [3-benzyl-1-(1-methylsulfonylpropan-2-yl)azetidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [3-benzyl-1-(1-methylsulfonylpropan-2-yl)azetidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 166623832 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [3-benzyl-1-(1-methylsulfonylpropan-2-yl)azetidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | CC(CS(C)(=O)=O)N1CC(Cc2ccccc2)(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C19H28N2O4S/c1-16(13-26(2,23)24)21-14-19(15-21,12-17-6-4-3-5-7-17)18(22)20-8-10-25-11-9-20/h3-7,16H,8-15H2,1-2H3 |
| InChIKey | DWNYIMTUNPPZBV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |