About [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate
[5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate (PubChem CID 166625264) has the molecular formula C16H13FN4O4S
and a molecular weight of 376.37 g/mol. Its IUPAC name is [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate.
Molecular Properties
| Compound Name | [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate |
| PubChem CID | 166625264 |
| Molecular Formula | C16H13FN4O4S |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)Oc2cc(N)n(S(=O)(=O)c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C16H13FN4O4S/c17-11-3-7-13(8-4-11)26(23,24)21-14(19)9-15(20-21)25-16(22)10-1-5-12(18)6-2-10/h1-9H,18-19H2 |
| InChIKey | ZZMFRFGVLXTEMP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate?
The IUPAC name of [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate (CID 166625264) is [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate.
What is the SMILES notation for [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate?
The canonical SMILES for [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate is Nc1ccc(C(=O)Oc2cc(N)n(S(=O)(=O)c3ccc(F)cc3)n2)cc1.
What is the InChIKey of [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate?
The InChIKey is ZZMFRFGVLXTEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN4O4S/c17-11-3-7-13(8-4-11)26(23,24)21-14(19)9-15(20-21)25-16(22)10-1-5-12(18)6-2-10/h1-9H,18-19H2.
What are the key properties of [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate?
[5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate has a molecular weight of 376.37 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-1-(4-fluorophenyl)sulfonylpyrazol-3-yl] 4-aminobenzoate is sourced from PubChem (CID 166625264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).