C16H10Cl3N3O4S — CID 4292383
[5-amino-1-(4-chlorophenyl)sulfonylpyrazol-3-yl] 2,4-dichlorobenzoate (PubChem CID 4292383) has the molecular formula C16H10Cl3N3O4S and a molecular weight of 446.70 g/mol. Its IUPAC name is [5-amino-1-(4-chlorophenyl)sulfonylpyrazol-3-yl] 2,4-dichlorobenzoate.
| Compound Name | [5-amino-1-(4-chlorophenyl)sulfonylpyrazol-3-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4292383 |
| Molecular Formula | C16H10Cl3N3O4S |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | [5-amino-1-(4-chlorophenyl)sulfonylpyrazol-3-yl] 2,4-dichlorobenzoate |
| SMILES | Nc1cc(OC(=O)c2ccc(Cl)cc2Cl)nn1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10Cl3N3O4S/c17-9-1-4-11(5-2-9)27(24,25)22-14(20)8-15(21-22)26-16(23)12-6-3-10(18)7-13(12)19/h1-8H,20H2 |
| InChIKey | VVAVVZONAUNWLH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |