C16H12F4N2O — CID 166626108
N-[3-(3-fluoro-4-methoxyphenyl)prop-2-ynyl]-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 166626108) has the molecular formula C16H12F4N2O and a molecular weight of 324.28 g/mol. Its IUPAC name is N-[3-(3-fluoro-4-methoxyphenyl)prop-2-ynyl]-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-[3-(3-fluoro-4-methoxyphenyl)prop-2-ynyl]-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 166626108 |
| Molecular Formula | C16H12F4N2O |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[3-(3-fluoro-4-methoxyphenyl)prop-2-ynyl]-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | COc1ccc(C#CCNc2ccnc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C16H12F4N2O/c1-23-14-5-4-11(9-13(14)17)3-2-7-21-12-6-8-22-15(10-12)16(18,19)20/h4-6,8-10H,7H2,1H3,(H,21,22) |
| InChIKey | SBRFGEZLYOIFDK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|