C22H19F3N2O2S — CID 166626265
(E)-3-[4-[methyl-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]amino]phenyl]prop-2-enoic acid (PubChem CID 166626265) has the molecular formula C22H19F3N2O2S and a molecular weight of 432.47 g/mol. Its IUPAC name is (E)-3-[4-[methyl-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[methyl-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166626265 |
| Molecular Formula | C22H19F3N2O2S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (E)-3-[4-[methyl-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1CN(C)c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C22H19F3N2O2S/c1-14-19(13-27(2)18-10-3-15(4-11-18)5-12-20(28)29)30-21(26-14)16-6-8-17(9-7-16)22(23,24)25/h3-12H,13H2,1-2H3,(H,28,29)/b12-5+ |
| InChIKey | HHJIVXLBOQLAPG-LFYBBSHMSA-N |
| XLogP | 5.87 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|