C23H19F3N6O2 — CID 16662651
[[(8aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-oxo-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]-(2-methoxyphenyl)methylidene]cyanamide (PubChem CID 16662651) has the molecular formula C23H19F3N6O2 and a molecular weight of 468.44 g/mol. Its IUPAC name is [[(8aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-oxo-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]-(2-methoxyphenyl)methylidene]cyanamide.
| Compound Name | [[(8aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-oxo-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]-(2-methoxyphenyl)methylidene]cyanamide |
|---|---|
| PubChem CID | 16662651 |
| Molecular Formula | C23H19F3N6O2 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [[(8aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-oxo-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]-(2-methoxyphenyl)methylidene]cyanamide |
| SMILES | COc1ccccc1/C(=N\C#N)N1CCN2C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C23H19F3N6O2/c1-34-20-5-3-2-4-18(20)21(29-14-28)30-8-9-31-17(12-30)13-32(22(31)33)16-7-6-15(11-27)19(10-16)23(24,25)26/h2-7,10,17H,8-9,12-13H2,1H3/b29-21+/t17-/m0/s1 |
| InChIKey | QQQPGQURCLNXPU-QJFNKMOXSA-N |
| XLogP | 3.44 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|