C35H43NO10 — CID 166626927
[(2R,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 1-[(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate (PubChem CID 166626927) has the molecular formula C35H43NO10 and a molecular weight of 637.73 g/mol. Its IUPAC name is [(2R,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 1-[(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate.
| Compound Name | [(2R,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 1-[(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 166626927 |
| Molecular Formula | C35H43NO10 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | [(2R,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 1-[(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate |
| SMILES | COc1cc(OC)c2c(c1)O[C@H](c1ccc(OC)c(OC)c1)[C@@H](OC(=O)C1CCN(Cc3cc(OC)c(OC)c(OC)c3)CC1)C2 |
| InChI | InChI=1S/C35H43NO10/c1-38-24-17-27(40-3)25-19-32(33(45-28(25)18-24)23-8-9-26(39-2)29(16-23)41-4)46-35(37)22-10-12-36(13-11-22)20-21-14-30(42-5)34(44-7)31(15-21)43-6/h8-9,14-18,22,32-33H,10-13,19-20H2,1-7H3/t32-,33+/m0/s1 |
| InChIKey | PQKMVPBCLAWDCH-JHOUSYSJSA-N |
| XLogP | 5.25 |
| TPSA | 103.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |