C19H16F4N2O — CID 166627540
N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-6-methoxy-2-methylquinolin-4-amine (PubChem CID 166627540) has the molecular formula C19H16F4N2O and a molecular weight of 364.34 g/mol. Its IUPAC name is N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-6-methoxy-2-methylquinolin-4-amine.
| Compound Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-6-methoxy-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 166627540 |
| Molecular Formula | C19H16F4N2O |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-6-methoxy-2-methylquinolin-4-amine |
| SMILES | COc1ccc2nc(C)cc(NCc3ccc(F)c(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C19H16F4N2O/c1-11-7-18(14-9-13(26-2)4-6-17(14)25-11)24-10-12-3-5-16(20)15(8-12)19(21,22)23/h3-9H,10H2,1-2H3,(H,24,25) |
| InChIKey | GVLAHODDQPNSSG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |