C25H24F4N2O2 — CID 166628640
(E)-3-[3,5-difluoro-4-[(1R,3S)-3-(fluoromethyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 166628640) has the molecular formula C25H24F4N2O2 and a molecular weight of 460.47 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[(1R,3S)-3-(fluoromethyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[(1R,3S)-3-(fluoromethyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166628640 |
| Molecular Formula | C25H24F4N2O2 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[(1R,3S)-3-(fluoromethyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(F)CN1[C@H](CF)Cc2c([nH]c3ccccc23)[C@H]1c1c(F)cc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C25H24F4N2O2/c1-25(2,29)13-31-15(12-26)11-17-16-5-3-4-6-20(16)30-23(17)24(31)22-18(27)9-14(10-19(22)28)7-8-21(32)33/h3-10,15,24,30H,11-13H2,1-2H3,(H,32,33)/b8-7+/t15-,24+/m0/s1 |
| InChIKey | COIALYHLVLQATA-FKCCRPNQSA-N |
| XLogP | 5.58 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|