C19H16ClN5O2 — CID 166628782
2-chloro-4-[(4-morpholin-4-yl-2-oxo-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile (PubChem CID 166628782) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-chloro-4-[(4-morpholin-4-yl-2-oxo-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[(4-morpholin-4-yl-2-oxo-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166628782 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-chloro-4-[(4-morpholin-4-yl-2-oxo-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(Nc2ccc3[nH]c(=O)cc(N4CCOCC4)c3c2)ccnc1Cl |
| InChI | InChI=1S/C19H16ClN5O2/c20-19-14(11-21)16(3-4-22-19)23-12-1-2-15-13(9-12)17(10-18(26)24-15)25-5-7-27-8-6-25/h1-4,9-10H,5-8H2,(H,22,23)(H,24,26) |
| InChIKey | HPISPCMULBBREF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|