C38H48N4O2 — CID 166629312
3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-methoxy-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one (PubChem CID 166629312) has the molecular formula C38H48N4O2 and a molecular weight of 592.83 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-methoxy-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-methoxy-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 166629312 |
| Molecular Formula | C38H48N4O2 |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.38 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-methoxy-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one |
| SMILES | COc1ccc2[nH]cc(CCCCN3CCN(c4ccc(C(=O)CCC5CCN(Cc6ccccc6)CC5)cc4)CC3)c2c1 |
| InChI | InChI=1S/C38H48N4O2/c1-44-35-15-16-37-36(27-35)33(28-39-37)9-5-6-20-40-23-25-42(26-24-40)34-13-11-32(12-14-34)38(43)17-10-30-18-21-41(22-19-30)29-31-7-3-2-4-8-31/h2-4,7-8,11-16,27-28,30,39H,5-6,9-10,17-26,29H2,1H3 |
| InChIKey | SOVSUZGCOSBSLP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|