C12H16O5 — CID 166629334
(1S,5R,6S)-5-hydroxy-1-[(1S)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 166629334) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (1S,5R,6S)-5-hydroxy-1-[(1S)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6S)-5-hydroxy-1-[(1S)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 166629334 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1S,5R,6S)-5-hydroxy-1-[(1S)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | COC1=CC(=O)[C@@]2([C@@H](O)C=C(C)C)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C12H16O5/c1-6(2)4-8(13)12-9(14)5-7(16-3)10(15)11(12)17-12/h4-5,8,10-11,13,15H,1-3H3/t8-,10-,11-,12+/m0/s1 |
| InChIKey | SLUGLTRVNZBPDS-PDEGPIFNSA-N |
| XLogP | -0.08 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|