C24H29F3N6O — CID 166631950
4-N-cyclohexyl-2-N-(2-methyl-4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 166631950) has the molecular formula C24H29F3N6O and a molecular weight of 474.53 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-(2-methyl-4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-2-N-(2-methyl-4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166631950 |
| Molecular Formula | C24H29F3N6O |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4-N-cyclohexyl-2-N-(2-methyl-4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(N2CCOCC2)ccc1Nc1nc(NC2CCCCC2)c2c(C(F)(F)F)c[nH]c2n1 |
| InChI | InChI=1S/C24H29F3N6O/c1-15-13-17(33-9-11-34-12-10-33)7-8-19(15)30-23-31-21-20(18(14-28-21)24(25,26)27)22(32-23)29-16-5-3-2-4-6-16/h7-8,13-14,16H,2-6,9-12H2,1H3,(H3,28,29,30,31,32) |
| InChIKey | YSDGZZDPLBXSAJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|